C8H14N2O — CID 163903234
6-amino-3-(ethylamino)cyclohexa-1,5-dien-1-ol (PubChem CID 163903234) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-amino-3-(ethylamino)cyclohexa-1,5-dien-1-ol.
| Compound Name | 6-amino-3-(ethylamino)cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 163903234 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 6-amino-3-(ethylamino)cyclohexa-1,5-dien-1-ol |
| SMILES | CCNC1C=C(O)C(N)=CC1 |
| InChI | InChI=1S/C8H14N2O/c1-2-10-6-3-4-7(9)8(11)5-6/h4-6,10-11H,2-3,9H2,1H3 |
| InChIKey | QLRPFBBMKVONCA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |