C8H13NO — CID 163996840
2,4,6-trimethyl-1,2-dihydropyridin-5-ol (PubChem CID 163996840) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,2-dihydropyridin-5-ol.
| Compound Name | 2,4,6-trimethyl-1,2-dihydropyridin-5-ol |
|---|---|
| PubChem CID | 163996840 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2,4,6-trimethyl-1,2-dihydropyridin-5-ol |
| SMILES | CC1=CC(C)NC(C)=C1O |
| InChI | InChI=1S/C8H13NO/c1-5-4-6(2)9-7(3)8(5)10/h4,6,9-10H,1-3H3 |
| InChIKey | UFKWBNZKXPTCSC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |