C18H17ClFN3O2S — CID 141340702
N-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-8-yl)-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 141340702) has the molecular formula C18H17ClFN3O2S and a molecular weight of 393.87 g/mol. Its IUPAC name is N-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-8-yl)-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-8-yl)-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 141340702 |
| Molecular Formula | C18H17ClFN3O2S |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-8-yl)-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCc2[nH]c3ccc(Cl)nc3c2C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17ClFN3O2S/c1-23(26(24,25)13-5-2-11(20)3-6-13)12-4-7-15-14(10-12)18-16(21-15)8-9-17(19)22-18/h2-3,5-6,8-9,12,21H,4,7,10H2,1H3 |
| InChIKey | IZHIPVNEOHSQKT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|