About 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide
7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide (PubChem CID 141340862) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide.
Molecular Properties
| Compound Name | 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide |
| PubChem CID | 141340862 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide |
| SMILES | O=S1CCC2(CCN(c3ccccc3)C2)C1 |
| InChI | InChI=1S/C13H17NOS/c15-16-9-7-13(11-16)6-8-14(10-13)12-4-2-1-3-5-12/h1-5H,6-11H2 |
| InChIKey | GYJUMTIOJPWFBZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide?
The IUPAC name of 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide (CID 141340862) is 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide.
What is the SMILES notation for 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide?
The canonical SMILES for 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide is O=S1CCC2(CCN(c3ccccc3)C2)C1.
What is the InChIKey of 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide?
The InChIKey is GYJUMTIOJPWFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NOS/c15-16-9-7-13(11-16)6-8-14(10-13)12-4-2-1-3-5-12/h1-5H,6-11H2.
What are the key properties of 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide?
7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide has a molecular weight of 235.35 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-2λ4-thia-7-azaspiro[4.4]nonane 2-oxide is sourced from PubChem (CID 141340862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).