C16H17ClN2O2 — CID 141344653
chloromethyl 3-[(2S)-2-methylpyrrolidin-1-yl]quinoline-6-carboxylate (PubChem CID 141344653) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is chloromethyl 3-[(2S)-2-methylpyrrolidin-1-yl]quinoline-6-carboxylate.
| Compound Name | chloromethyl 3-[(2S)-2-methylpyrrolidin-1-yl]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 141344653 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | chloromethyl 3-[(2S)-2-methylpyrrolidin-1-yl]quinoline-6-carboxylate |
| SMILES | C[C@H]1CCCN1c1cnc2ccc(C(=O)OCCl)cc2c1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-11-3-2-6-19(11)14-8-13-7-12(16(20)21-10-17)4-5-15(13)18-9-14/h4-5,7-9,11H,2-3,6,10H2,1H3/t11-/m0/s1 |
| InChIKey | RLKUFCJOBURYLK-NSHDSACASA-N |
| XLogP | 3.58 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|