C17H23N6O12P3 — CID 14134854
[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-methylphenyl)phosphonamidic acid (PubChem CID 14134854) has the molecular formula C17H23N6O12P3 and a molecular weight of 596.32 g/mol. Its IUPAC name is [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-methylphenyl)phosphonamidic acid.
| Compound Name | [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-methylphenyl)phosphonamidic acid |
|---|---|
| PubChem CID | 14134854 |
| Molecular Formula | C17H23N6O12P3 |
| Molecular Weight | 596.32 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-methylphenyl)phosphonamidic acid |
| SMILES | Cc1ccc(NP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H23N6O12P3/c1-9-2-4-10(5-3-9)22-36(26,27)34-38(30,31)35-37(28,29)32-6-11-13(24)14(25)17(33-11)23-8-21-12-15(18)19-7-20-16(12)23/h2-5,7-8,11,13-14,17,24-25H,6H2,1H3,(H,28,29)(H,30,31)(H2,18,19,20)(H2,22,26,27)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | UJYDSYJRUMJAJJ-LSCFUAHRSA-N |
| XLogP | 0.80 |
| TPSA | 270.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|