C16H20N9O12P3 — CID 3035480
[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-azidophenyl)phosphonamidic acid (PubChem CID 3035480) has the molecular formula C16H20N9O12P3 and a molecular weight of 623.31 g/mol. Its IUPAC name is [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-azidophenyl)phosphonamidic acid.
| Compound Name | [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-azidophenyl)phosphonamidic acid |
|---|---|
| PubChem CID | 3035480 |
| Molecular Formula | C16H20N9O12P3 |
| Molecular Weight | 623.31 g/mol |
| Exact Mass | 623.04 |
| IUPAC Name | [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-(4-azidophenyl)phosphonamidic acid |
| SMILES | [N-]=[N+]=Nc1ccc(NP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H20N9O12P3/c17-14-11-15(20-6-19-14)25(7-21-11)16-13(27)12(26)10(35-16)5-34-39(30,31)37-40(32,33)36-38(28,29)23-9-3-1-8(2-4-9)22-24-18/h1-4,6-7,10,12-13,16,26-27H,5H2,(H,30,31)(H,32,33)(H2,17,19,20)(H2,23,28,29)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | JAOXVBKJGMCNRK-XNIJJKJLSA-N |
| XLogP | 1.43 |
| TPSA | 319.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|