About bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate
bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate (PubChem CID 141355000) has the molecular formula C29H26Cl2O5
and a molecular weight of 525.43 g/mol. Its IUPAC name is bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate.
Molecular Properties
| Compound Name | bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate |
| PubChem CID | 141355000 |
| Molecular Formula | C29H26Cl2O5 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate |
| SMILES | CC(C)(Cl)C(=O)c1ccc(C(OC(=O)C(=O)c2ccccc2)c2ccc(C(=O)C(C)(C)Cl)cc2)cc1 |
| InChI | InChI=1S/C29H26Cl2O5/c1-28(2,30)25(33)21-14-10-19(11-15-21)24(36-27(35)23(32)18-8-6-5-7-9-18)20-12-16-22(17-13-20)26(34)29(3,4)31/h5-17,24H,1-4H3 |
| InChIKey | KQXSGGPDZOWQDA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate?
The IUPAC name of bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate (CID 141355000) is bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate.
What is the SMILES notation for bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate?
The canonical SMILES for bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate is CC(C)(Cl)C(=O)c1ccc(C(OC(=O)C(=O)c2ccccc2)c2ccc(C(=O)C(C)(C)Cl)cc2)cc1.
What is the InChIKey of bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate?
The InChIKey is KQXSGGPDZOWQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26Cl2O5/c1-28(2,30)25(33)21-14-10-19(11-15-21)24(36-27(35)23(32)18-8-6-5-7-9-18)20-12-16-22(17-13-20)26(34)29(3,4)31/h5-17,24H,1-4H3.
What are the key properties of bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate?
bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate has a molecular weight of 525.43 g/mol, XLogP of 6.60, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(2-chloro-2-methylpropanoyl)phenyl]methyl 2-oxo-2-phenylacetate is sourced from PubChem (CID 141355000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).