C22H19N5OS — CID 141360777
1-(3-acetylphenyl)-3-[4-(3-methyl-2H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]thiourea (PubChem CID 141360777) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(3-methyl-2H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]thiourea.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(3-methyl-2H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 141360777 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(3-methyl-2H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]thiourea |
| SMILES | CC(=O)c1cccc(NC(=S)Nc2ccc(-c3ccnc4n[nH]c(C)c34)cc2)c1 |
| InChI | InChI=1S/C22H19N5OS/c1-13-20-19(10-11-23-21(20)27-26-13)15-6-8-17(9-7-15)24-22(29)25-18-5-3-4-16(12-18)14(2)28/h3-12H,1-2H3,(H,23,26,27)(H2,24,25,29) |
| InChIKey | QZIDTEHGDBAVJF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|