C15H19F3N2O3 — CID 141361889
methyl 3-carbamoyl-5-(pentan-3-ylamino)-2-(trifluoromethyl)benzoate (PubChem CID 141361889) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is methyl 3-carbamoyl-5-(pentan-3-ylamino)-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 3-carbamoyl-5-(pentan-3-ylamino)-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 141361889 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl 3-carbamoyl-5-(pentan-3-ylamino)-2-(trifluoromethyl)benzoate |
| SMILES | CCC(CC)Nc1cc(C(N)=O)c(C(F)(F)F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-4-8(5-2)20-9-6-10(13(19)21)12(15(16,17)18)11(7-9)14(22)23-3/h6-8,20H,4-5H2,1-3H3,(H2,19,21) |
| InChIKey | CQOZDAJCMLCRSJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |