C10H20N2O6 — CID 141369081
4-[2-(2,6-dihydroxymorpholin-4-yl)ethyl]morpholine-2,6-diol (PubChem CID 141369081) has the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-[2-(2,6-dihydroxymorpholin-4-yl)ethyl]morpholine-2,6-diol.
| Compound Name | 4-[2-(2,6-dihydroxymorpholin-4-yl)ethyl]morpholine-2,6-diol |
|---|---|
| PubChem CID | 141369081 |
| Molecular Formula | C10H20N2O6 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-[2-(2,6-dihydroxymorpholin-4-yl)ethyl]morpholine-2,6-diol |
| SMILES | OC1CN(CCN2CC(O)OC(O)C2)CC(O)O1 |
| InChI | InChI=1S/C10H20N2O6/c13-7-3-11(4-8(14)17-7)1-2-12-5-9(15)18-10(16)6-12/h7-10,13-16H,1-6H2 |
| InChIKey | MZKRQIXVXLNJJG-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |