C16H19NO — CID 141372749
4-[(4-methoxyphenyl)methyl]-3-methyl-2-prop-2-enyl-1H-pyrrole (PubChem CID 141372749) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-3-methyl-2-prop-2-enyl-1H-pyrrole.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-3-methyl-2-prop-2-enyl-1H-pyrrole |
|---|---|
| PubChem CID | 141372749 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-3-methyl-2-prop-2-enyl-1H-pyrrole |
| SMILES | C=CCc1[nH]cc(Cc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C16H19NO/c1-4-5-16-12(2)14(11-17-16)10-13-6-8-15(18-3)9-7-13/h4,6-9,11,17H,1,5,10H2,2-3H3 |
| InChIKey | GUJUPLNNTRSVEH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|