C17H33N3O2Si — CID 141377057
N-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-3-yl]-2-methylpentanamide (PubChem CID 141377057) has the molecular formula C17H33N3O2Si and a molecular weight of 339.56 g/mol. Its IUPAC name is N-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-3-yl]-2-methylpentanamide.
| Compound Name | N-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-3-yl]-2-methylpentanamide |
|---|---|
| PubChem CID | 141377057 |
| Molecular Formula | C17H33N3O2Si |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-3-yl]-2-methylpentanamide |
| SMILES | CCCC(C)C(=O)Nc1ccn(CCO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C17H33N3O2Si/c1-8-9-14(2)16(21)18-15-10-11-20(19-15)12-13-22-23(6,7)17(3,4)5/h10-11,14H,8-9,12-13H2,1-7H3,(H,18,19,21) |
| InChIKey | CUWQVPVPELGLFY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|