C18H30BrNO3Si — CID 12016938
N-(2-bromo-4-methoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanamide (PubChem CID 12016938) has the molecular formula C18H30BrNO3Si and a molecular weight of 416.43 g/mol. Its IUPAC name is N-(2-bromo-4-methoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanamide.
| Compound Name | N-(2-bromo-4-methoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanamide |
|---|---|
| PubChem CID | 12016938 |
| Molecular Formula | C18H30BrNO3Si |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(2-bromo-4-methoxyphenyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanamide |
| SMILES | COc1ccc(NC(=O)C(C)CCO[Si](C)(C)C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C18H30BrNO3Si/c1-13(10-11-23-24(6,7)18(2,3)4)17(21)20-16-9-8-14(22-5)12-15(16)19/h8-9,12-13H,10-11H2,1-7H3,(H,20,21) |
| InChIKey | XDJUCXONZUCMJM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|