C16H15ClN2 — CID 141377182
4-[2-(5-chloro-3-pyridinyl)ethynyl]-N,N,3-trimethylaniline (PubChem CID 141377182) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-[2-(5-chloro-3-pyridinyl)ethynyl]-N,N,3-trimethylaniline.
| Compound Name | 4-[2-(5-chloro-3-pyridinyl)ethynyl]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 141377182 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-[2-(5-chloro-3-pyridinyl)ethynyl]-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1C#Cc1cncc(Cl)c1 |
| InChI | InChI=1S/C16H15ClN2/c1-12-8-16(19(2)3)7-6-14(12)5-4-13-9-15(17)11-18-10-13/h6-11H,1-3H3 |
| InChIKey | FWMYKGNUIJALPL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|