C36H42N2O2S — CID 141377390
2,3-bis(3-hexoxyphenyl)-5-thiophen-2-yl-6,7-dihydroquinoxaline (PubChem CID 141377390) has the molecular formula C36H42N2O2S and a molecular weight of 566.81 g/mol. Its IUPAC name is 2,3-bis(3-hexoxyphenyl)-5-thiophen-2-yl-6,7-dihydroquinoxaline.
| Compound Name | 2,3-bis(3-hexoxyphenyl)-5-thiophen-2-yl-6,7-dihydroquinoxaline |
|---|---|
| PubChem CID | 141377390 |
| Molecular Formula | C36H42N2O2S |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 2,3-bis(3-hexoxyphenyl)-5-thiophen-2-yl-6,7-dihydroquinoxaline |
| SMILES | CCCCCCOc1cccc(-c2nc3c(nc2-c2cccc(OCCCCCC)c2)=C(c2cccs2)CCC=3)c1 |
| InChI | InChI=1S/C36H42N2O2S/c1-3-5-7-9-22-39-29-17-11-15-27(25-29)34-35(28-16-12-18-30(26-28)40-23-10-8-6-4-2)38-36-31(33-21-14-24-41-33)19-13-20-32(36)37-34/h11-12,14-18,20-21,24-26H,3-10,13,19,22-23H2,1-2H3 |
| InChIKey | LPJDGKGYXAYERJ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|