C21H23N9O5 — CID 141378319
2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]acetamide (PubChem CID 141378319) has the molecular formula C21H23N9O5 and a molecular weight of 481.47 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]acetamide.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 141378319 |
| Molecular Formula | C21H23N9O5 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2nnc(NC(=O)CNC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)o2)cc1 |
| InChI | InChI=1S/C21H23N9O5/c1-10-2-4-11(5-3-10)19-28-29-21(35-19)27-13(31)7-23-6-12-15(32)16(33)20(34-12)30-9-26-14-17(22)24-8-25-18(14)30/h2-5,8-9,12,15-16,20,23,32-33H,6-7H2,1H3,(H2,22,24,25)(H,27,29,31)/t12-,15-,16-,20-/m1/s1 |
| InChIKey | LNLZVGMPTONKKG-VXHCAWKWSA-N |
| XLogP | -0.39 |
| TPSA | 199.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |