C23H21N3O3 — CID 141379177
4-[[4-(5-ethynyl-1-oxo-2H-isoquinolin-3-yl)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 141379177) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-[[4-(5-ethynyl-1-oxo-2H-isoquinolin-3-yl)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[4-(5-ethynyl-1-oxo-2H-isoquinolin-3-yl)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141379177 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-[[4-(5-ethynyl-1-oxo-2H-isoquinolin-3-yl)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | C#Cc1cccc2c(=O)[nH]c(-c3ccc(CN4CCN(C(=O)O)CC4)cc3)cc12 |
| InChI | InChI=1S/C23H21N3O3/c1-2-17-4-3-5-19-20(17)14-21(24-22(19)27)18-8-6-16(7-9-18)15-25-10-12-26(13-11-25)23(28)29/h1,3-9,14H,10-13,15H2,(H,24,27)(H,28,29) |
| InChIKey | NPGZTXZCOYXTQC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|