C19H18FIN4O2 — CID 156501305
4-[[4-(6-fluoro-3-iodo-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 156501305) has the molecular formula C19H18FIN4O2 and a molecular weight of 480.28 g/mol. Its IUPAC name is 4-[[4-(6-fluoro-3-iodo-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[4-(6-fluoro-3-iodo-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 156501305 |
| Molecular Formula | C19H18FIN4O2 |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 4-[[4-(6-fluoro-3-iodo-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2ccc(-c3cc4c(I)[nH]nc4cc3F)cc2)CC1 |
| InChI | InChI=1S/C19H18FIN4O2/c20-16-10-17-15(18(21)23-22-17)9-14(16)13-3-1-12(2-4-13)11-24-5-7-25(8-6-24)19(26)27/h1-4,9-10H,5-8,11H2,(H,22,23)(H,26,27) |
| InChIKey | HBGOCQHGWDJCKO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|