C24H29IN4O2 — CID 156792740
tert-butyl 4-[[4-(3-iodo-6-methyl-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 156792740) has the molecular formula C24H29IN4O2 and a molecular weight of 532.43 g/mol. Its IUPAC name is tert-butyl 4-[[4-(3-iodo-6-methyl-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(3-iodo-6-methyl-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156792740 |
| Molecular Formula | C24H29IN4O2 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | tert-butyl 4-[[4-(3-iodo-6-methyl-2H-indazol-5-yl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1cc2n[nH]c(I)c2cc1-c1ccc(CN2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H29IN4O2/c1-16-13-21-20(22(25)27-26-21)14-19(16)18-7-5-17(6-8-18)15-28-9-11-29(12-10-28)23(30)31-24(2,3)4/h5-8,13-14H,9-12,15H2,1-4H3,(H,26,27) |
| InChIKey | LSLUNPIVKGZOGN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|