C17H19N5O2S — CID 141381347
6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]imidazo[1,2-a]pyrazine (PubChem CID 141381347) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]imidazo[1,2-a]pyrazine.
| Compound Name | 6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 141381347 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]imidazo[1,2-a]pyrazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(-c3cn4ccnc4cn3)cc2)CC1 |
| InChI | InChI=1S/C17H19N5O2S/c1-20-8-10-22(11-9-20)25(23,24)15-4-2-14(3-5-15)16-13-21-7-6-18-17(21)12-19-16/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | CVPPSRWZJZCVJF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |