C10H16N4 — CID 141381960
1-(5-ethenyl-1-methyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 141381960) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-(5-ethenyl-1-methyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | 1-(5-ethenyl-1-methyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 141381960 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-(5-ethenyl-1-methyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | C=Cc1nc(N2CCCCC2)nn1C |
| InChI | InChI=1S/C10H16N4/c1-3-9-11-10(12-13(9)2)14-7-5-4-6-8-14/h3H,1,4-8H2,2H3 |
| InChIKey | OEKMQLFHIAEBJT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |