C10H18N4 — CID 66821363
5-pentyl-1-prop-2-enyl-1,2,4-triazol-3-amine (PubChem CID 66821363) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-pentyl-1-prop-2-enyl-1,2,4-triazol-3-amine.
| Compound Name | 5-pentyl-1-prop-2-enyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66821363 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 5-pentyl-1-prop-2-enyl-1,2,4-triazol-3-amine |
| SMILES | C=CCn1nc(N)nc1CCCCC |
| InChI | InChI=1S/C10H18N4/c1-3-5-6-7-9-12-10(11)13-14(9)8-4-2/h4H,2-3,5-8H2,1H3,(H2,11,13) |
| InChIKey | JGCTZDUNGPKQDC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|