C19H22N4O3 — CID 141382853
1-[4-[(4-methyl-2-phenyl-1,3-oxazol-5-yl)methyl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 141382853) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[4-[(4-methyl-2-phenyl-1,3-oxazol-5-yl)methyl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(4-methyl-2-phenyl-1,3-oxazol-5-yl)methyl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141382853 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[4-[(4-methyl-2-phenyl-1,3-oxazol-5-yl)methyl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(-c2ccccc2)oc1CN1CCN(N2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C19H22N4O3/c1-14-16(26-19(20-14)15-5-3-2-4-6-15)13-21-9-11-22(12-10-21)23-17(24)7-8-18(23)25/h2-6H,7-13H2,1H3 |
| InChIKey | JBWCIXWIHBIANM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|