C5H12N3NaS2 — CID 141385731
sodium N,N-bis(ethylamino)carbamodithioate (PubChem CID 141385731) has the molecular formula C5H12N3NaS2 and a molecular weight of 201.30 g/mol. Its IUPAC name is sodium N,N-bis(ethylamino)carbamodithioate.
| Compound Name | sodium N,N-bis(ethylamino)carbamodithioate |
|---|---|
| PubChem CID | 141385731 |
| Molecular Formula | C5H12N3NaS2 |
| Molecular Weight | 201.30 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | sodium N,N-bis(ethylamino)carbamodithioate |
| SMILES | CCNN(NCC)C(=S)[S-].[Na+] |
| InChI | InChI=1S/C5H13N3S2.Na/c1-3-6-8(5(9)10)7-4-2;/h6-7H,3-4H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | GWZJPYBCSYWOIQ-UHFFFAOYSA-M |
| XLogP | -2.83 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.30 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|