C17H17N7O — CID 141386326
2-amino-4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]imidazo[2,1-f][1,2,4]triazine-7-carbonitrile (PubChem CID 141386326) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-amino-4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]imidazo[2,1-f][1,2,4]triazine-7-carbonitrile.
| Compound Name | 2-amino-4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]imidazo[2,1-f][1,2,4]triazine-7-carbonitrile |
|---|---|
| PubChem CID | 141386326 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-amino-4-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]imidazo[2,1-f][1,2,4]triazine-7-carbonitrile |
| SMILES | COc1ccc(CN(c2nc(N)nn3c(C#N)cnc23)C2CC2)cc1 |
| InChI | InChI=1S/C17H17N7O/c1-25-14-6-2-11(3-7-14)10-23(12-4-5-12)16-15-20-9-13(8-18)24(15)22-17(19)21-16/h2-3,6-7,9,12H,4-5,10H2,1H3,(H2,19,22) |
| InChIKey | MYQGKFRFMUAIFT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|