C26H26BrN7O2 — CID 162390683
8-[(6-bromo-2-pyridinyl)-[(4-methoxyphenyl)methyl]amino]-6-[(2-hydroxycyclohexyl)amino]imidazo[1,2-b]pyridazine-3-carbonitrile (PubChem CID 162390683) has the molecular formula C26H26BrN7O2 and a molecular weight of 548.45 g/mol. Its IUPAC name is 8-[(6-bromo-2-pyridinyl)-[(4-methoxyphenyl)methyl]amino]-6-[(2-hydroxycyclohexyl)amino]imidazo[1,2-b]pyridazine-3-carbonitrile.
| Compound Name | 8-[(6-bromo-2-pyridinyl)-[(4-methoxyphenyl)methyl]amino]-6-[(2-hydroxycyclohexyl)amino]imidazo[1,2-b]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 162390683 |
| Molecular Formula | C26H26BrN7O2 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 8-[(6-bromo-2-pyridinyl)-[(4-methoxyphenyl)methyl]amino]-6-[(2-hydroxycyclohexyl)amino]imidazo[1,2-b]pyridazine-3-carbonitrile |
| SMILES | COc1ccc(CN(c2cccc(Br)n2)c2cc(NC3CCCCC3O)nn3c(C#N)cnc23)cc1 |
| InChI | InChI=1S/C26H26BrN7O2/c1-36-19-11-9-17(10-12-19)16-33(25-8-4-7-23(27)31-25)21-13-24(30-20-5-2-3-6-22(20)35)32-34-18(14-28)15-29-26(21)34/h4,7-13,15,20,22,35H,2-3,5-6,16H2,1H3,(H,30,32) |
| InChIKey | XQNRXQMZDBPLHY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|