C28H31N7O — CID 59314055
8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-6-[4-(diethylamino)anilino]imidazo[1,2-b]pyridazine-3-carbonitrile (PubChem CID 59314055) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is 8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-6-[4-(diethylamino)anilino]imidazo[1,2-b]pyridazine-3-carbonitrile.
| Compound Name | 8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-6-[4-(diethylamino)anilino]imidazo[1,2-b]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 59314055 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-6-[4-(diethylamino)anilino]imidazo[1,2-b]pyridazine-3-carbonitrile |
| SMILES | CCN(CC)c1ccc(Nc2cc(N(Cc3ccc(OC)cc3)C3CC3)c3ncc(C#N)n3n2)cc1 |
| InChI | InChI=1S/C28H31N7O/c1-4-33(5-2)22-10-8-21(9-11-22)31-27-16-26(28-30-18-24(17-29)35(28)32-27)34(23-12-13-23)19-20-6-14-25(36-3)15-7-20/h6-11,14-16,18,23H,4-5,12-13,19H2,1-3H3,(H,31,32) |
| InChIKey | QBAMONXVNDNTPF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|