C22H35N5O3 — CID 141387412
(2R)-3-[[5-amino-1-(2-hydroxy-2-methylpropyl)indazol-4-yl]amino]-2-tert-butylazepane-1-carboxylic acid (PubChem CID 141387412) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2R)-3-[[5-amino-1-(2-hydroxy-2-methylpropyl)indazol-4-yl]amino]-2-tert-butylazepane-1-carboxylic acid.
| Compound Name | (2R)-3-[[5-amino-1-(2-hydroxy-2-methylpropyl)indazol-4-yl]amino]-2-tert-butylazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 141387412 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (2R)-3-[[5-amino-1-(2-hydroxy-2-methylpropyl)indazol-4-yl]amino]-2-tert-butylazepane-1-carboxylic acid |
| SMILES | CC(C)(O)Cn1ncc2c(NC3CCCCN(C(=O)O)[C@@H]3C(C)(C)C)c(N)ccc21 |
| InChI | InChI=1S/C22H35N5O3/c1-21(2,3)19-16(8-6-7-11-26(19)20(28)29)25-18-14-12-24-27(13-22(4,5)30)17(14)10-9-15(18)23/h9-10,12,16,19,25,30H,6-8,11,13,23H2,1-5H3,(H,28,29)/t16?,19-/m0/s1 |
| InChIKey | KDFUXNZVKBTLSU-CVMIBEPCSA-N |
| XLogP | 3.75 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|