C24H40FN5O3Si — CID 153424233
tert-butyl N-[(3R)-1-[5-amino-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-fluoroindazol-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 153424233) has the molecular formula C24H40FN5O3Si and a molecular weight of 493.70 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[5-amino-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-fluoroindazol-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[5-amino-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-fluoroindazol-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 153424233 |
| Molecular Formula | C24H40FN5O3Si |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | tert-butyl N-[(3R)-1-[5-amino-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-fluoroindazol-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2c(N)cc(F)c3c2cnn3CCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H40FN5O3Si/c1-23(2,3)33-22(31)28-16-9-10-29(15-16)21-17-14-27-30(20(17)18(25)13-19(21)26)11-12-32-34(7,8)24(4,5)6/h13-14,16H,9-12,15,26H2,1-8H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | VEWODQYBOKEWOK-MRXNPFEDSA-N |
| XLogP | 4.88 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|