About triazin-4-yl 4-methylbenzoate
triazin-4-yl 4-methylbenzoate (PubChem CID 141387968) has the molecular formula C11H9N3O2
and a molecular weight of 215.21 g/mol. Its IUPAC name is triazin-4-yl 4-methylbenzoate.
Molecular Properties
| Compound Name | triazin-4-yl 4-methylbenzoate |
| PubChem CID | 141387968 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | triazin-4-yl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccnnn2)cc1 |
| InChI | InChI=1S/C11H9N3O2/c1-8-2-4-9(5-3-8)11(15)16-10-6-7-12-14-13-10/h2-7H,1H3 |
| InChIKey | VBZJTTSSXSQLKW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze triazin-4-yl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazin-4-yl 4-methylbenzoate?
The IUPAC name of triazin-4-yl 4-methylbenzoate (CID 141387968) is triazin-4-yl 4-methylbenzoate.
What is the SMILES notation for triazin-4-yl 4-methylbenzoate?
The canonical SMILES for triazin-4-yl 4-methylbenzoate is Cc1ccc(C(=O)Oc2ccnnn2)cc1.
What is the InChIKey of triazin-4-yl 4-methylbenzoate?
The InChIKey is VBZJTTSSXSQLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2/c1-8-2-4-9(5-3-8)11(15)16-10-6-7-12-14-13-10/h2-7H,1H3.
What are the key properties of triazin-4-yl 4-methylbenzoate?
triazin-4-yl 4-methylbenzoate has a molecular weight of 215.21 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazin-4-yl 4-methylbenzoate is sourced from PubChem (CID 141387968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).