C17H12BrN3O4 — CID 141389337
2-[[(5S)-3-(5-bromo-2-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione (PubChem CID 141389337) has the molecular formula C17H12BrN3O4 and a molecular weight of 402.20 g/mol. Its IUPAC name is 2-[[(5S)-3-(5-bromo-2-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(5S)-3-(5-bromo-2-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141389337 |
| Molecular Formula | C17H12BrN3O4 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 2-[[(5S)-3-(5-bromo-2-pyridinyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H]1CN(c2ccc(Br)cn2)C(=O)O1 |
| InChI | InChI=1S/C17H12BrN3O4/c18-10-5-6-14(19-7-10)20-8-11(25-17(20)24)9-21-15(22)12-3-1-2-4-13(12)16(21)23/h1-7,11H,8-9H2/t11-/m1/s1 |
| InChIKey | KTPHNOVLDFBGDU-LLVKDONJSA-N |
| XLogP | 2.47 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|