C27H24N4O5 — CID 141391008
2-[[(5S)-3-[4-(2-morpholin-4-yl-3-pyridinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione (PubChem CID 141391008) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-[[(5S)-3-[4-(2-morpholin-4-yl-3-pyridinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(5S)-3-[4-(2-morpholin-4-yl-3-pyridinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141391008 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[[(5S)-3-[4-(2-morpholin-4-yl-3-pyridinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H]1CN(c2ccc(-c3cccnc3N3CCOCC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C27H24N4O5/c32-25-22-4-1-2-5-23(22)26(33)31(25)17-20-16-30(27(34)36-20)19-9-7-18(8-10-19)21-6-3-11-28-24(21)29-12-14-35-15-13-29/h1-11,20H,12-17H2/t20-/m1/s1 |
| InChIKey | VAMLGNXKUAOKIH-HXUWFJFHSA-N |
| XLogP | 3.21 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|