C22H18FN3O6 — CID 59410776
2-[[(5S)-3-[2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione (PubChem CID 59410776) has the molecular formula C22H18FN3O6 and a molecular weight of 439.40 g/mol. Its IUPAC name is 2-[[(5S)-3-[2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(5S)-3-[2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59410776 |
| Molecular Formula | C22H18FN3O6 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-[[(5S)-3-[2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H]1CN(c2ccc(N3CCOCC3=O)cc2F)C(=O)O1 |
| InChI | InChI=1S/C22H18FN3O6/c23-17-9-13(24-7-8-31-12-19(24)27)5-6-18(17)25-10-14(32-22(25)30)11-26-20(28)15-3-1-2-4-16(15)21(26)29/h1-6,9,14H,7-8,10-12H2/t14-/m1/s1 |
| InChIKey | GULUIDVHWWGPKB-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|