C27H23FN4O6 — CID 11620561
5-[4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]furan-2-carbaldehyde (PubChem CID 11620561) has the molecular formula C27H23FN4O6 and a molecular weight of 518.50 g/mol. Its IUPAC name is 5-[4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]furan-2-carbaldehyde.
| Compound Name | 5-[4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 11620561 |
| Molecular Formula | C27H23FN4O6 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 5-[4-[4-[(5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(N2CCN(c3ccc(N4C[C@H](CN5C(=O)c6ccccc6C5=O)OC4=O)cc3F)CC2)o1 |
| InChI | InChI=1S/C27H23FN4O6/c28-22-13-17(5-7-23(22)29-9-11-30(12-10-29)24-8-6-18(16-33)37-24)31-14-19(38-27(31)36)15-32-25(34)20-3-1-2-4-21(20)26(32)35/h1-8,13,16,19H,9-12,14-15H2/t19-/m1/s1 |
| InChIKey | VNIFXFNZYXOAFQ-LJQANCHMSA-N |
| XLogP | 3.18 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|