C18H13FN2O4 — CID 58721924
2-[[(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione (PubChem CID 58721924) has the molecular formula C18H13FN2O4 and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-[[(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58721924 |
| Molecular Formula | C18H13FN2O4 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-[[(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H]1CN(c2cccc(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H13FN2O4/c19-11-4-3-5-12(8-11)20-9-13(25-18(20)24)10-21-16(22)14-6-1-2-7-15(14)17(21)23/h1-8,13H,9-10H2/t13-/m1/s1 |
| InChIKey | LBCWDQHUICWDRI-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|