C18H13BrFNO3 — CID 147978636
2-[[(2R)-6-bromo-8-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl]isoindole-1,3-dione (PubChem CID 147978636) has the molecular formula C18H13BrFNO3 and a molecular weight of 390.21 g/mol. Its IUPAC name is 2-[[(2R)-6-bromo-8-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2R)-6-bromo-8-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 147978636 |
| Molecular Formula | C18H13BrFNO3 |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-[[(2R)-6-bromo-8-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H]1CCc2cc(Br)cc(F)c2O1 |
| InChI | InChI=1S/C18H13BrFNO3/c19-11-7-10-5-6-12(24-16(10)15(20)8-11)9-21-17(22)13-3-1-2-4-14(13)18(21)23/h1-4,7-8,12H,5-6,9H2/t12-/m1/s1 |
| InChIKey | ISUBXMHBAWAWII-GFCCVEGCSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|