C19H15Cl2F3N2 — CID 141390521
8-chloro-6-[4-chloro-3-(trifluoromethyl)phenyl]-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 141390521) has the molecular formula C19H15Cl2F3N2 and a molecular weight of 399.24 g/mol. Its IUPAC name is 8-chloro-6-[4-chloro-3-(trifluoromethyl)phenyl]-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 8-chloro-6-[4-chloro-3-(trifluoromethyl)phenyl]-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 141390521 |
| Molecular Formula | C19H15Cl2F3N2 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 8-chloro-6-[4-chloro-3-(trifluoromethyl)phenyl]-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | Cc1c2n(c3c(-c4ccc(Cl)c(C(F)(F)F)c4)cc(Cl)cc13)CCNC2 |
| InChI | InChI=1S/C19H15Cl2F3N2/c1-10-13-7-12(20)8-14(18(13)26-5-4-25-9-17(10)26)11-2-3-16(21)15(6-11)19(22,23)24/h2-3,6-8,25H,4-5,9H2,1H3 |
| InChIKey | OVIKCYVINUNLCK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|