C16H25N5 — CID 141392242
N-cyclopentyl-4-(1,7-diazaspiro[4.4]nonan-7-yl)pyrimidin-2-amine (PubChem CID 141392242) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-cyclopentyl-4-(1,7-diazaspiro[4.4]nonan-7-yl)pyrimidin-2-amine.
| Compound Name | N-cyclopentyl-4-(1,7-diazaspiro[4.4]nonan-7-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 141392242 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-cyclopentyl-4-(1,7-diazaspiro[4.4]nonan-7-yl)pyrimidin-2-amine |
| SMILES | c1cc(N2CCC3(CCCN3)C2)nc(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H25N5/c1-2-5-13(4-1)19-15-17-10-6-14(20-15)21-11-8-16(12-21)7-3-9-18-16/h6,10,13,18H,1-5,7-9,11-12H2,(H,17,19,20) |
| InChIKey | GHZHVQJUTZCTLS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |