C14H30N4O13P2 — CID 141394080
azanium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 141394080) has the molecular formula C14H30N4O13P2 and a molecular weight of 524.36 g/mol. Its IUPAC name is azanium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | azanium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 141394080 |
| Molecular Formula | C14H30N4O13P2 |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | azanium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]2O)c(=O)[nH]1.[NH4+] |
| InChI | InChI=1S/C9H14N2O12P2.C5H14NO.H3N/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;1-6(2,3)4-5-7;/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18);7H,4-5H2,1-3H3;1H3/q;+1;/p-1/t4-,6-,7-,8-;;/m1../s1 |
| InChIKey | RJBWWCZGTJASFB-WFIJOQBCSA-M |
| XLogP | -3.82 |
| TPSA | 280.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|