C24H46N2O4 — CID 141398298
2-[2-hydroxyethyl-[1-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]acetic acid (PubChem CID 141398298) has the molecular formula C24H46N2O4 and a molecular weight of 426.64 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[1-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-hydroxyethyl-[1-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 141398298 |
| Molecular Formula | C24H46N2O4 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 2-[2-hydroxyethyl-[1-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]acetic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(C)N(CCO)CC(=O)O |
| InChI | InChI=1S/C24H46N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(28)25-22(2)26(19-20-27)21-24(29)30/h10-11,22,27H,3-9,12-21H2,1-2H3,(H,25,28)(H,29,30)/b11-10- |
| InChIKey | NIBUENRBSPCGKE-KHPPLWFESA-N |
| XLogP | 4.86 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|