C27H26FNO3 — CID 141398506
3-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoic acid (PubChem CID 141398506) has the molecular formula C27H26FNO3 and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoic acid.
| Compound Name | 3-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 141398506 |
| Molecular Formula | C27H26FNO3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(C2CC2)cc(OCC2CN(C(c3ccccc3)c3ccccc3)C2)c1F |
| InChI | InChI=1S/C27H26FNO3/c28-25-23(27(30)31)13-22(19-11-12-19)14-24(25)32-17-18-15-29(16-18)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,13-14,18-19,26H,11-12,15-17H2,(H,30,31) |
| InChIKey | MIQJMLPOCARNGT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |