C20H24N4O2S — CID 141399453
tert-butyl 4-[4-(5-cyano-4-methyl-1,3-thiazol-2-yl)phenyl]piperazine-1-carboxylate (PubChem CID 141399453) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is tert-butyl 4-[4-(5-cyano-4-methyl-1,3-thiazol-2-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(5-cyano-4-methyl-1,3-thiazol-2-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141399453 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | tert-butyl 4-[4-(5-cyano-4-methyl-1,3-thiazol-2-yl)phenyl]piperazine-1-carboxylate |
| SMILES | Cc1nc(-c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)sc1C#N |
| InChI | InChI=1S/C20H24N4O2S/c1-14-17(13-21)27-18(22-14)15-5-7-16(8-6-15)23-9-11-24(12-10-23)19(25)26-20(2,3)4/h5-8H,9-12H2,1-4H3 |
| InChIKey | RQRASRBLATYPEI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|