C20H29F17N2O5SSi — CID 141400055
N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(triethoxysilylmethyl)octane-1-sulfonamide (PubChem CID 141400055) has the molecular formula C20H29F17N2O5SSi and a molecular weight of 760.58 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(triethoxysilylmethyl)octane-1-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(triethoxysilylmethyl)octane-1-sulfonamide |
|---|---|
| PubChem CID | 141400055 |
| Molecular Formula | C20H29F17N2O5SSi |
| Molecular Weight | 760.58 g/mol |
| Exact Mass | 760.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(triethoxysilylmethyl)octane-1-sulfonamide |
| SMILES | CCO[Si](CN(CCCN(C)C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C20H29F17N2O5SSi/c1-6-42-46(43-7-2,44-8-3)12-39(11-9-10-38(4)5)45(40,41)20(36,37)18(31,32)16(27,28)14(23,24)13(21,22)15(25,26)17(29,30)19(33,34)35/h6-12H2,1-5H3 |
| InChIKey | PCQYJCBWLIPYCZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|