About 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine
2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine (PubChem CID 14140369) has the molecular formula C9H15N5S
and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine |
| PubChem CID | 14140369 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine |
| SMILES | NC(N)=Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C9H15N5S/c10-8(11)12-9-14-13-7(15-9)6-4-2-1-3-5-6/h6H,1-5H2,(H4,10,11,12,14) |
| InChIKey | IPXRXQQQJZDGQB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine?
The IUPAC name of 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine (CID 14140369) is 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine.
What is the SMILES notation for 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine?
The canonical SMILES for 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine is NC(N)=Nc1nnc(C2CCCCC2)s1.
What is the InChIKey of 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine?
The InChIKey is IPXRXQQQJZDGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5S/c10-8(11)12-9-14-13-7(15-9)6-4-2-1-3-5-6/h6H,1-5H2,(H4,10,11,12,14).
What are the key properties of 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine?
2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine has a molecular weight of 225.32 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)guanidine is sourced from PubChem (CID 14140369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).