C15H19F3N6S2 — CID 123883980
5-[3-[5-(5,5,5-trifluoropentan-2-ylideneamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-amine (PubChem CID 123883980) has the molecular formula C15H19F3N6S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-[3-[5-(5,5,5-trifluoropentan-2-ylideneamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3-[5-(5,5,5-trifluoropentan-2-ylideneamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 123883980 |
| Molecular Formula | C15H19F3N6S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 5-[3-[5-(5,5,5-trifluoropentan-2-ylideneamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(CCC(F)(F)F)=Nc1nnc(C2CCCC(c3nnc(N)s3)C2)s1 |
| InChI | InChI=1S/C15H19F3N6S2/c1-8(5-6-15(16,17)18)20-14-24-22-12(26-14)10-4-2-3-9(7-10)11-21-23-13(19)25-11/h9-10H,2-7H2,1H3,(H2,19,23) |
| InChIKey | ONHXGHXOAOGIKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|