C8H12IN3S — CID 21454636
5-(4-iodocyclohexyl)-1,3,4-thiadiazol-2-amine (PubChem CID 21454636) has the molecular formula C8H12IN3S and a molecular weight of 309.18 g/mol. Its IUPAC name is 5-(4-iodocyclohexyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-iodocyclohexyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 21454636 |
| Molecular Formula | C8H12IN3S |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 5-(4-iodocyclohexyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(C2CCC(I)CC2)s1 |
| InChI | InChI=1S/C8H12IN3S/c9-6-3-1-5(2-4-6)7-11-12-8(10)13-7/h5-6H,1-4H2,(H2,10,12) |
| InChIKey | QRBRJANHKNOEKG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|