C9H13N3S — CID 123584574
5-(3-ethenylcyclopentyl)-1,3,4-thiadiazol-2-amine (PubChem CID 123584574) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-(3-ethenylcyclopentyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-ethenylcyclopentyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 123584574 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5-(3-ethenylcyclopentyl)-1,3,4-thiadiazol-2-amine |
| SMILES | C=CC1CCC(c2nnc(N)s2)C1 |
| InChI | InChI=1S/C9H13N3S/c1-2-6-3-4-7(5-6)8-11-12-9(10)13-8/h2,6-7H,1,3-5H2,(H2,10,12) |
| InChIKey | BYTGUISYSOJONK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|