C14H21N5S2 — CID 123298397
5-[3-(7-imino-4-methyl-5,6-dihydro-4H-1,3-thiazepin-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-amine (PubChem CID 123298397) has the molecular formula C14H21N5S2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 5-[3-(7-imino-4-methyl-5,6-dihydro-4H-1,3-thiazepin-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3-(7-imino-4-methyl-5,6-dihydro-4H-1,3-thiazepin-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 123298397 |
| Molecular Formula | C14H21N5S2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-[3-(7-imino-4-methyl-5,6-dihydro-4H-1,3-thiazepin-2-yl)cyclohexyl]-1,3,4-thiadiazol-2-amine |
| SMILES | [H]/N=C1\CCC(C)N=C(C2CCCC(c3nnc(N)s3)C2)S1 |
| InChI | InChI=1S/C14H21N5S2/c1-8-5-6-11(15)20-12(17-8)9-3-2-4-10(7-9)13-18-19-14(16)21-13/h8-10,15H,2-7H2,1H3,(H2,16,19)/b15-11+ |
| InChIKey | NJDWJGVNZOIBSI-RVDMUPIBSA-N |
| XLogP | 3.69 |
| TPSA | 88.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|