C22H29NO2 — CID 141405550
(8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile (PubChem CID 141405550) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile |
|---|---|
| PubChem CID | 141405550 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile |
| SMILES | C[C@]12CCC3(C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(C#N)=CC[C@@H]12)OCCO3 |
| InChI | InChI=1S/C22H29NO2/c1-20-8-7-19-17(18(20)6-4-16(20)14-23)5-3-15-13-22(24-11-12-25-22)10-9-21(15,19)2/h4,13,17-19H,3,5-12H2,1-2H3/t17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | LQTCGERVYJPFQM-FCMAGTKHSA-N |
| XLogP | 4.75 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|